CymitQuimica logo

CAS 730980-59-3

:

(R)-Chroman-4-ylamine hydrochloride

Description:
(R)-Chroman-4-ylamine hydrochloride is a chemical compound characterized by its chiral structure, which includes a chroman ring system. This compound features an amine functional group, contributing to its potential as a pharmacologically active agent. The hydrochloride salt form enhances its solubility in water, making it suitable for various applications in medicinal chemistry and drug formulation. The presence of the (R) configuration indicates that it is one of the enantiomers of chroman-4-ylamine, which can exhibit different biological activities compared to its (S) counterpart. This compound may be of interest in research related to neuropharmacology, as compounds with similar structures have been investigated for their effects on neurotransmitter systems. Additionally, its unique structural features may allow for specific interactions with biological targets, potentially leading to therapeutic applications. As with many amines, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:C9H12ClNO
InChI:InChI=1S/C9H11NO.ClH/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-4,8H,5-6,10H2;1H/t8-;/m1./s1
InChI key:BVMKYKMJUZEGBU-DDWIOCJRSA-N
SMILES:C1COC2=CC=CC=C2[C@@H]1N.Cl
Found 4 products.