CAS 730992-39-9
:1-Hydroxy-6-(1-piperidinylsulfonyl)-1H-benzimidazole
Description:
1-Hydroxy-6-(1-piperidinylsulfonyl)-1H-benzimidazole, identified by its CAS number 730992-39-9, is a chemical compound that belongs to the class of benzimidazole derivatives. This compound features a benzimidazole core, which is a bicyclic structure composed of a fused benzene and imidazole ring, contributing to its biological activity. The presence of a hydroxy group at the 1-position and a piperidinylsulfonyl group at the 6-position enhances its solubility and potential interactions with biological targets. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activities such as antimicrobial, anti-inflammatory, or anticancer effects. Its structural characteristics allow for various modifications, which can influence its efficacy and selectivity in biological systems. As with many synthetic compounds, understanding its stability, reactivity, and interaction with other molecules is crucial for its application in research and potential therapeutic uses.
Formula:C12H15N3O3S
InChI:InChI=1S/C12H15N3O3S/c16-15-9-13-11-5-4-10(8-12(11)15)19(17,18)14-6-2-1-3-7-14/h4-5,8-9,16H,1-3,6-7H2
InChI key:InChIKey=MVQDUVNZEGDDJM-UHFFFAOYSA-N
SMILES:ON1C=2C(=CC=C(S(=O)(=O)N3CCCCC3)C2)N=C1
Synonyms:- 1H-Benzimidazole, 1-hydroxy-6-(1-piperidinylsulfonyl)-
- Piperidine, 1-[(1-hydroxy-1H-benzimidazol-6-yl)sulfonyl]-
- 1-Hydroxy-6-(1-piperidinylsulfonyl)-1H-benzimidazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.