CAS 730992-43-5

4-[(6-Amino-1,2,3,4-tetrahydro-2,4-dioxo-1-propyl-5-pyrimidinyl)butylamino]-4-oxobutanoic acid

Description:

The chemical substance known as 4-[(6-Amino-1,2,3,4-tetrahydro-2,4-dioxo-1-propyl-5-pyrimidinyl)butylamino]-4-oxobutanoic acid, with the CAS number 730992-43-5, is a complex organic compound characterized by its unique structural features. It contains a pyrimidine ring, which is a six-membered aromatic heterocycle with nitrogen atoms, and is substituted with various functional groups, including amino and carbonyl groups. This compound exhibits properties typical of amino acids and may participate in various biochemical interactions due to its ability to form hydrogen bonds and engage in ionic interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. The presence of multiple functional groups also indicates that it may exhibit solubility in polar solvents and could be involved in enzyme-substrate interactions. Overall, this compound's intricate structure and functional diversity make it a subject of interest for further research in both synthetic and medicinal chemistry.

Formula: C₁₅H₂₄N₄O₅

InChI: InChI=1S/C15H24N4O5/c1-3-5-9-18(10(20)6-7-11(21)22)12-13(16)19(8-4-2)15(24)17-14(12)23/h3-9,16H2,1-2H3,(H,21,22)(H,17,23,24)

InChI key: InChIKey=ISTNBZBQHQUYLS-UHFFFAOYSA-N

SMILES: N(C(CCC(O)=O)=O)(CCCC)C1=C(N)N(CCC)C(=O)NC1=O

Synonyms:

• Butanoic acid, 4-[(6-amino-1,2,3,4-tetrahydro-2,4-dioxo-1-propyl-5-pyrimidinyl)butylamino]-4-oxo-
• 4-[(6-Amino-1,2,3,4-tetrahydro-2,4-dioxo-1-propyl-5-pyrimidinyl)butylamino]-4-oxobutanoic acid