CymitQuimica logo

CAS 731002-12-3

:

3-Formyl-1H-pyrrole-1-propanenitrile

Description:
3-Formyl-1H-pyrrole-1-propanenitrile is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features a formyl group (-CHO) and a propanenitrile group (-C≡N) attached to the pyrrole, contributing to its reactivity and potential applications in organic synthesis. The presence of the formyl group allows for further functionalization, making it a versatile intermediate in the synthesis of various bioactive molecules. Additionally, the nitrile group can participate in nucleophilic addition reactions, enhancing its utility in chemical transformations. The compound is typically a solid or liquid at room temperature, depending on its purity and specific conditions. Its properties, such as solubility and melting point, can vary based on the solvent and environmental conditions. Due to its unique structure, 3-Formyl-1H-pyrrole-1-propanenitrile may exhibit interesting biological activities, making it a subject of interest in medicinal chemistry and materials science.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c9-3-1-4-10-5-2-8(6-10)7-11/h2,5-7H,1,4H2
InChI key:InChIKey=GCNXTSZRYOBXEU-UHFFFAOYSA-N
SMILES:C(CC#N)N1C=C(C=O)C=C1
Synonyms:
  • 1H-Pyrrole-1-propanenitrile, 3-formyl-
  • 3-Formyl-1H-pyrrole-1-propanenitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.