CAS 731003-85-3

N-[(3-Bromophenyl)sulfonyl]glycine

Description:

N-[(3-Bromophenyl)sulfonyl]glycine is a chemical compound characterized by its sulfonamide functional group, which is linked to a glycine moiety. This compound features a brominated phenyl group, specifically at the meta position, which contributes to its unique reactivity and potential biological activity. The sulfonyl group enhances the compound's solubility in polar solvents and can influence its interaction with biological targets. Typically, compounds of this nature are studied for their potential applications in medicinal chemistry, particularly as inhibitors or modulators of specific enzymes or receptors. The presence of the bromine atom may also impart specific electronic properties, affecting the compound's overall stability and reactivity. Additionally, the compound's structure suggests it may participate in hydrogen bonding due to the amino and carboxyl groups of glycine, which can further influence its biological interactions. Overall, N-[(3-Bromophenyl)sulfonyl]glycine is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals.

Formula: C₈H₈BrNO₄S

InChI: InChI=1S/C8H8BrNO4S/c9-6-2-1-3-7(4-6)15(13,14)10-5-8(11)12/h1-4,10H,5H2,(H,11,12)

InChI key: InChIKey=KOUIFODJIUCFDM-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=CC(Br)=CC=C1

Synonyms:

• 2-(3-Bromobenzenesulfonamido)acetic acid
• Glycine, N-[(3-bromophenyl)sulfonyl]-
• N-[(3-Bromophenyl)sulfonyl]glycine
• ([(3-Bromophenyl)sulfonyl]amino)acetic acid