CAS 731003-88-6

N-[(4-Bromo-2-chlorophenyl)sulfonyl]glycine

Description:

N-[(4-Bromo-2-chlorophenyl)sulfonyl]glycine, with the CAS number 731003-88-6, is a chemical compound characterized by its sulfonamide functional group, which is linked to a glycine moiety. This compound features a phenyl ring that is substituted with both bromine and chlorine atoms, contributing to its unique reactivity and potential biological activity. The presence of the sulfonyl group enhances its solubility in polar solvents and may influence its interaction with biological targets. Typically, compounds of this nature are studied for their potential pharmaceutical applications, particularly in the development of drugs targeting specific enzymes or receptors. The halogen substitutions can also affect the compound's electronic properties, stability, and overall pharmacokinetics. As with many sulfonamides, it may exhibit antibacterial or anti-inflammatory properties, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₈H₇BrClNO₄S

InChI: InChI=1S/C8H7BrClNO4S/c9-5-1-2-7(6(10)3-5)16(14,15)11-4-8(12)13/h1-3,11H,4H2,(H,12,13)

InChI key: InChIKey=KLOLJDKVVISHRN-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=C(Cl)C=C(Br)C=C1

Synonyms:

• N-[(4-Bromo-2-chlorophenyl)sulfonyl]glycine
• Glycine, N-[(4-bromo-2-chlorophenyl)sulfonyl]-

2-(4-Bromo-2-chlorobenzenesulfonamido)acetic acid

CAS: 731003-88-6

Versatile small molecule scaffold

Formula: C₈H₇BrClNO₄S

Purity: Min. 95%

Molecular weight: 328.57 g/mol

Ref: 3D-GEB00388