CAS 731011-87-3

Propanamide, 2-chloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-

Description:

Propanamide, 2-chloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]- is a chemical compound characterized by its amide functional group, which is indicative of its potential as a polar molecule with hydrogen bonding capabilities. The presence of chlorine and trifluoromethyl groups suggests that it may exhibit significant lipophilicity and potential reactivity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The pyridine ring contributes to its aromaticity and may influence its electronic properties, enhancing its stability and reactivity. This compound is likely to be solid at room temperature, with a specific melting point and solubility characteristics influenced by its functional groups. Additionally, the presence of multiple halogen substituents can affect its biological activity and environmental persistence. As with many halogenated compounds, it is essential to consider its safety profile, including toxicity and environmental impact, during handling and application. Overall, this compound exemplifies the complexity and diversity of modern synthetic organic chemistry.

Formula: C₉H₇Cl₂F₃N₂O

InChI: InChI=1S/C9H7Cl2F3N2O/c1-4(10)8(17)16-7-6(11)2-5(3-15-7)9(12,13)14/h2-4H,1H3,(H,15,16,17)

InChI key: InChIKey=SYJOJINJYYDHFL-UHFFFAOYSA-N

SMILES: N(C(C(C)Cl)=O)C1=C(Cl)C=C(C(F)(F)F)C=N1

Synonyms:

• 2-Chloro-N-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]propanamide
• Propanamide, 2-chloro-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]-