CAS 731011-97-5
:2-Chloro-N-(2-phenylethyl)-N-(phenylmethyl)propanamide
Description:
2-Chloro-N-(2-phenylethyl)-N-(phenylmethyl)propanamide is a chemical compound characterized by its amide functional group, which is indicative of its potential biological activity. The presence of a chloro substituent suggests that it may exhibit unique reactivity and solubility properties. The compound features a propanamide backbone, with two distinct aromatic groups: a phenylethyl group and a phenylmethyl group, contributing to its steric and electronic characteristics. This structural arrangement may influence its interactions with biological targets, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may possess lipophilic properties, which could affect its pharmacokinetics and bioavailability. Additionally, the chlorine atom may enhance its binding affinity to certain receptors or enzymes. Overall, 2-Chloro-N-(2-phenylethyl)-N-(phenylmethyl)propanamide represents a complex organic molecule that could be explored for various applications, particularly in drug development and synthesis.
Formula:C18H20ClNO
InChI:InChI=1S/C18H20ClNO/c1-15(19)18(21)20(14-17-10-6-3-7-11-17)13-12-16-8-4-2-5-9-16/h2-11,15H,12-14H2,1H3
InChI key:InChIKey=LSRHPQSEFFYWNF-UHFFFAOYSA-N
SMILES:N(CC1=CC=CC=C1)(CCC2=CC=CC=C2)C(C(C)Cl)=O
Synonyms:- Propanamide, 2-chloro-N-(2-phenylethyl)-N-(phenylmethyl)-
- 2-Chloro-N-(2-phenylethyl)-N-(phenylmethyl)propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.