CAS 731016-45-8
:B-[9-(4-Methylphenyl)-9H-carbazol-3-yl]boronic acid
Description:
B-[9-(4-Methylphenyl)-9H-carbazol-3-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and is widely used in organic synthesis and medicinal chemistry. This compound features a carbazole moiety, which contributes to its potential electronic properties, making it of interest in the development of organic semiconductors and optoelectronic devices. The presence of the 4-methylphenyl group enhances its solubility and may influence its reactivity and interaction with biological targets. Typically, boronic acids exhibit moderate stability under ambient conditions but can be sensitive to moisture and air, necessitating careful handling. The compound's unique structure may also impart specific optical properties, making it suitable for applications in fluorescence and photonics. Overall, B-[9-(4-Methylphenyl)-9H-carbazol-3-yl]boronic acid represents a versatile building block in the synthesis of complex organic molecules and materials.
Formula:C19H16BNO2
InChI:InChI=1S/C19H16BNO2/c1-13-6-9-15(10-7-13)21-18-5-3-2-4-16(18)17-12-14(20(22)23)8-11-19(17)21/h2-12,22-23H,1H3
InChI key:InChIKey=GYFSBCDGBBWMBE-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C=C2C(N(C=3C2=CC=CC3)C4=CC=C(C)C=C4)=CC1
Synonyms:- Boronic acid, [9-(4-methylphenyl)-9H-carbazol-3-yl]-
- Boronic acid, B-[9-(4-methylphenyl)-9H-carbazol-3-yl]-
- B-[9-(4-Methylphenyl)-9H-carbazol-3-yl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
