CAS 73109-31-6

2-(4-methylphenyl)isoquinoline-1,3(2H,4H)-dione

Description:

2-(4-Methylphenyl)isoquinoline-1,3(2H,4H)-dione, with the CAS number 73109-31-6, is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This compound features a 4-methylphenyl group, indicating the presence of a methyl substituent on the phenyl ring, which can influence its chemical reactivity and physical properties. The dione functional groups suggest that it contains two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic addition and condensation reactions. The presence of these functional groups often contributes to the compound's biological activity, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure may exhibit specific optical properties, such as fluorescence, depending on its electronic configuration. Overall, 2-(4-methylphenyl)isoquinoline-1,3(2H,4H)-dione is a complex organic molecule with potential applications in pharmaceuticals and materials science.

Formula: C₁₆H₁₃NO₂

InChI: InChI=1/C16H13NO2/c1-11-6-8-13(9-7-11)17-15(18)10-12-4-2-3-5-14(12)16(17)19/h2-9H,10H2,1H3

SMILES: Cc1ccc(cc1)N1C(=O)Cc2ccccc2C1=O

Synonyms:

• 1,3(2H,4H)-isoquinolinedione, 2-(4-methylphenyl)-
• 2-p-Tolyl-4H-isoquinoline-1,3-dione