CAS 7311-70-8

2,5-dibromothiophene-3-carboxylic acid

Description:

2,5-Dibromothiophene-3-carboxylic acid is an organic compound characterized by its thiophene ring structure, which is a five-membered aromatic heterocycle containing sulfur. The presence of two bromine substituents at the 2 and 5 positions of the thiophene ring significantly influences its chemical properties, including increased reactivity and potential for electrophilic substitution reactions. The carboxylic acid functional group at the 3-position contributes to its acidity and solubility in polar solvents. This compound is typically used in organic synthesis and materials science, particularly in the development of electronic materials and pharmaceuticals. Its unique structure allows for various applications in the synthesis of more complex molecules. Additionally, the presence of bromine atoms can facilitate further functionalization, making it a versatile intermediate in chemical reactions. Safety considerations should be taken into account due to the potential hazards associated with brominated compounds. Overall, 2,5-dibromothiophene-3-carboxylic acid is a valuable compound in the field of organic chemistry.

Formula: C₅H₂Br₂O₂S

InChI: InChI=1/C5H2Br2O2S/c6-3-1-2(5(8)9)4(7)10-3/h1H,(H,8,9)

SMILES: c1c(c(Br)sc1Br)C(=O)O

2,5-Dibromothiophene-3-carboxylic Acid

CAS: 7311-70-8

Formula: C₅H₂Br₂O₂S

Purity: >96.0%(GC)(T)

Color and Shape: White to Almost white powder to crystal

Molecular weight: 285.94

Ref: 3B-D4582

2,5-dibromo-thiophene-3-carboxylic acid

CAS: 7311-70-8

Formula: C₅H₂Br₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 285.9412

Ref: IN-DA0036QL

2,5-Dibromothiophene-3-carboxylic acid

CAS: 7311-70-8

2,5-Dibromothiophene-3-carboxylic acid

Purity: 97%

Molecular weight: 285.94g/mol

Ref: 54-OR6629

2,5-Dibromothiophene-3-carboxylic acid

CAS: 7311-70-8

Formula: C₅H₂Br₂O₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 285.94

Ref: 10-F235337