CAS 73112-09-1

2-cyanopyridine-3-carboxylic acid

Description:

2-Cyanopyridine-3-carboxylic acid, with the CAS number 73112-09-1, is an organic compound that features a pyridine ring substituted with both a cyano group and a carboxylic acid group. This compound typically exhibits a white to off-white crystalline appearance. It is characterized by its polar nature due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding, enhancing its solubility in polar solvents like water and alcohols. The cyano group contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the preparation of pharmaceuticals and agrochemicals. The compound may also exhibit biological activity, which can be explored for potential applications in medicinal chemistry. Its melting point, boiling point, and specific reactivity can vary based on environmental conditions and purity. As with many organic compounds, proper handling and storage are essential to maintain its stability and prevent degradation.

Formula: C₇H₄N₂O₂

InChI: InChI=1/C7H4N2O2/c8-4-6-5(7(10)11)2-1-3-9-6/h1-3H,(H,10,11)

SMILES: C1=CC(=C(C#N)N=C1)C(=O)O

Synonyms:

• 2-Cyanonicotinic acid
• 3-Pyridinecarboxylic Acid, 2-Cyano-

2-Cyanonicotinic acid

CAS: 73112-09-1

Formula: C₇H₄N₂O₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 148.1189

Ref: IN-DA0038GP

2-Cyanopyridine-3-carboxylic acid

CAS: 73112-09-1

2-Cyanopyridine-3-carboxylic acid

Purity: 95%

Molecular weight: 148.12g/mol

Ref: 54-OR93489

2-Cyanopyridine-3-carboxylic acid

CAS: 73112-09-1

Purity: 95%

Molecular weight: 148.1210022

Ref: 10-F651679