CAS 7312-10-9

5-bromo-1-benzothiophene-2-carboxylic acid

Description:

5-Bromo-1-benzothiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a benzothiophene ring system substituted with a bromine atom and a carboxylic acid functional group. The presence of the bromine atom enhances its reactivity and can influence its physical properties, such as solubility and boiling point. The carboxylic acid group contributes to its acidity and potential for forming hydrogen bonds, which can affect its interactions in various chemical environments. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure allows for various functionalization reactions, making it a versatile building block in synthetic chemistry. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the solvent and conditions used in experiments. Overall, 5-bromo-1-benzothiophene-2-carboxylic acid is a valuable compound in the field of organic chemistry due to its distinctive features and reactivity.

Formula: C₉H₅BrO₂S

InChI: InChI=1/C9H5BrO2S/c10-6-1-2-7-5(3-6)4-8(13-7)9(11)12/h1-4H,(H,11,12)

SMILES: c1cc2c(cc1Br)cc(C(=O)O)s2

Synonyms:

• 5-bromobenzo[b]thiophene-2-carboxylic acid
• 5-bromo-1-benzothiophene-2-carboxylate
• 5-BROMO-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID
• Benzo[b]thiophene-2-carboxylic acid, 5-bromo-
• 5-BROMO-1-BENZOTHIOPHENE-2-CARBOXYLIC ACID
• 5-bromo-1,3-benzothiazole-2-carboxylic acid
• 5-Bromo-1-benzothiophene-2-carboxylic acid, 5-Bromo-2-carboxy-1-benzothiophene

5-Bromo-1-Benzothiophene-2-Carboxylic Acid

CAS: 7312-10-9

Formula: C₉H₅BrO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 257.1038

Ref: IN-DA0039F1

5-Bromobenzo[b]thiophene-2-carboxylic acid

CAS: 7312-10-9

5-Bromobenzo[b]thiophene-2-carboxylic acid

Formula: C₉H₅BrO₂S

Purity: ≥95%

Color and Shape: white powder

Molecular weight: 257.10g/mol

Ref: 54-OR2826

5-Bromo-1-benzothiophene-2-carboxylic acid

CAS: 7312-10-9

Formula: C₉H₅BrO₂S

Purity: 95%

Color and Shape: Beige powder

Molecular weight: 257.1

Ref: 10-F066291