CymitQuimica logo

CAS 7312-18-7

:

5-bromobenzo[b]thiophene-2-carbaldehyde

Description:
5-Bromobenzo[b]thiophene-2-carbaldehyde is an organic compound characterized by its unique structure, which includes a bromine atom and a thiophene ring fused to a benzene ring. This compound features an aldehyde functional group (-CHO) at the 2-position of the thiophene, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions and coupling reactions. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its aromatic nature and the presence of heteroatoms in the thiophene ring can influence its electronic properties, making it of interest in materials science and medicinal chemistry. Additionally, compounds like this one can serve as intermediates in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as with many halogenated organic substances, due to potential toxicity and environmental concerns.
Formula:C9H5BrOS
InChI:InChI=1S/C9H5BrOS/c10-7-1-2-9-6(3-7)4-8(5-11)12-9/h1-5H
InChI key:JCWGQAINAKCVJX-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1Br)C=C(S2)C=O
Found 4 products.