CAS 7312-25-6

Methyl 5-bromobenzo[b]thiophene-3-carboxylate

Description:

Methyl 5-bromobenzo[b]thiophene-3-carboxylate is an organic compound characterized by its unique structure, which includes a bromine atom and a thiophene ring fused to a benzene ring. This compound features a carboxylate ester functional group, which contributes to its reactivity and solubility properties. The presence of the bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. Methyl 5-bromobenzo[b]thiophene-3-carboxylate is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its applications can be found in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Overall, this compound is of interest in both academic research and industrial applications.

Formula: C₁₀H₇BrO₂S

InChI: InChI=1S/C10H7BrO2S/c1-13-10(12)8-5-14-9-3-2-6(11)4-7(8)9/h2-5H,1H3

InChI key: InChIKey=QZNZVRWWWOWDRV-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(SC1)=CC=C(Br)C2

Synonyms:

• Benzo[b]thiophene-3-carboxylic acid, 5-bromo-, methyl ester
• Methyl 5-bromobenzo[b]thiophene-3-carboxylate