CAS 73120-41-9

Phenol, 2,5-dimethoxy-4-methyl-

Description:

Phenol, 2,5-dimethoxy-4-methyl- is an organic compound characterized by its aromatic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This specific phenol derivative features two methoxy groups (-OCH3) at the 2 and 5 positions and a methyl group (-CH3) at the 4 position of the aromatic ring. The presence of these substituents influences its chemical properties, including its solubility, reactivity, and potential biological activity. Generally, methoxy groups can enhance the compound's lipophilicity, affecting its interaction with biological membranes. This compound may exhibit antioxidant properties and has potential applications in pharmaceuticals and organic synthesis. Additionally, its structure suggests that it could participate in various chemical reactions, such as electrophilic aromatic substitution. As with many phenolic compounds, it is important to handle it with care due to potential toxicity and environmental impact. Overall, 2,5-dimethoxy-4-methylphenol is a notable compound in the field of organic chemistry with diverse implications in research and industry.

Formula: C₉H₁₂O₃

InChI: InChI=1/C9H12O3/c1-6-4-9(12-3)7(10)5-8(6)11-2/h4-5,10H,1-3H3

SMILES: Cc1cc(c(cc1OC)O)OC

Synonyms:

• 2,5-Dimethoxy-4-methyl-phenol

2,5-dimethoxy-4-methylphenol

CAS: 73120-41-9

2,5-dimethoxy-4-methylphenol

Purity: ≥95%

Molecular weight: 168.19g/mol

Ref: 54-OR22774