CAS 73120-67-9

4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid

Description:

4-[4-(2-methylpropyl)phenyl]-4-oxobutanoic acid, with the CAS number 73120-67-9, is an organic compound characterized by its complex structure, which includes a butanoic acid moiety and a phenyl group substituted with a branched alkyl chain. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications. The presence of the carboxylic acid group suggests it can participate in acid-base reactions, while the aromatic ring may contribute to its stability and reactivity in organic synthesis. Additionally, the branched alkyl substituent can influence its solubility and interaction with other molecules. Such compounds are often studied for their potential roles in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₄H₁₈O₃

InChI: InChI=1/C14H18O3/c1-10(2)9-11-3-5-12(6-4-11)13(15)7-8-14(16)17/h3-6,10H,7-9H2,1-2H3,(H,16,17)

SMILES: CC(C)Cc1ccc(cc1)C(=O)CCC(=O)O

Synonyms:

• Benzenebutanoic acid, 4-(2-methylpropyl)-gamma-oxo-

4-(4-isobutylphenyl)-4-oxobutanoic acid

CAS: 73120-67-9

Formula: C₁₄H₁₈O₃

Molecular weight: 234.2909

Ref: IN-DA00VTY0

4-[4-(2-Methylpropyl)phenyl]-4-oxobutanoic acid

CAS: 73120-67-9

Versatile small molecule scaffold

Formula: C₁₄H₁₈O₃

Purity: Min. 95%

Molecular weight: 234.29 g/mol

Ref: 3D-YCA12067