CAS 73120-83-9

2-[(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)(methyl)amino]ethanol

Description:

2-[(2,3-dihydro-1,4-benzodioxin-2-ylmethyl)(methyl)amino]ethanol, with the CAS number 73120-83-9, is a chemical compound characterized by its complex structure that includes a benzodioxin moiety and an ethanolamine functional group. This compound typically exhibits properties associated with both amines and alcohols, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the benzodioxin ring may impart unique pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with biological systems, potentially influencing neurotransmitter pathways or exhibiting other biological activities. Additionally, the compound's stability, reactivity, and potential applications in drug development or as a biochemical probe would depend on its specific functional groups and steric configuration. As with many organic compounds, safety and handling precautions should be observed, particularly regarding its potential toxicity and environmental impact.

Formula: C₁₂H₁₇NO₃

InChI: InChI=1/C12H17NO3/c1-13(6-7-14)8-10-9-15-11-4-2-3-5-12(11)16-10/h2-5,10,14H,6-9H2,1H3

SMILES: CN(CCO)CC1COc2ccccc2O1