CymitQuimica logo

CAS 73122-61-9

:

Vinylacetylglycine

Description:
Vinylacetylglycine, with the CAS number 73122-61-9, is an organic compound characterized by its functional groups, which include both a vinyl group and an acetylglycine moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar organic solvents, which makes it useful in various chemical applications. Vinylacetylglycine can participate in polymerization reactions due to the presence of the vinyl group, allowing it to be incorporated into larger macromolecular structures. Additionally, the acetylglycine part of the molecule contributes to its potential as a building block in the synthesis of more complex organic compounds. The compound may exhibit biological activity, making it of interest in medicinal chemistry and materials science. As with many organic compounds, handling precautions should be observed due to potential reactivity and toxicity. Overall, vinylacetylglycine serves as a versatile intermediate in organic synthesis and polymer chemistry.
Formula:C6H9NO3
InChI:InChI=1S/C6H9NO3/c1-2-3-5(8)7-4-6(9)10/h2H,1,3-4H2,(H,7,8)(H,9,10)
InChI key:InChIKey=UKISAGFGRDHYFO-UHFFFAOYSA-N
SMILES:C(NCC(O)=O)(CC=C)=O
Synonyms:
  • 2-(But-3-enamido)acetic acid
  • Glycine, N-(1-oxo-3-butenyl)-
  • Glycine, N-(1-oxo-3-buten-1-yl)-
  • N-(1-Oxo-3-buten-1-yl)glycine
  • Vinylacetylglycine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.