CymitQuimica logo

CAS 73123-48-5

:

4-(1-Methylpropyl)-1H-pyrazole

Description:
4-(1-Methylpropyl)-1H-pyrazole, identified by its CAS number 73123-48-5, is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. This compound features a 1-methylpropyl group attached to the fourth position of the pyrazole ring, influencing its chemical properties and reactivity. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the alkyl group contributes to its hydrophobic characteristics, making it less soluble in water but more soluble in organic solvents. 4-(1-Methylpropyl)-1H-pyrazole may exhibit biological activity, which can be of interest in various fields, including pharmaceuticals and agrochemicals. Its stability and reactivity can be influenced by factors such as temperature and the presence of other chemical species. As with many pyrazole derivatives, it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions, making it a versatile compound in synthetic chemistry.
Formula:C7H12N2
InChI:InChI=1S/C7H12N2/c1-3-6(2)7-4-8-9-5-7/h4-6H,3H2,1-2H3,(H,8,9)
InChI key:InChIKey=IGSGRZGYPSFKAS-UHFFFAOYSA-N
SMILES:C(CC)(C)C=1C=NNC1
Synonyms:
  • 4-(1-Methylpropyl)-1H-pyrazole
  • 1H-Pyrazole, 4-(1-methylpropyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.