CymitQuimica logo

CAS 7313-22-6

:

N,N,N',N'-tetramethylpropanediamide

Description:
N,N,N',N'-Tetramethylpropanediamide, with the CAS number 7313-22-6, is an organic compound characterized by its amide functional groups and a symmetrical structure. It features a central propane backbone with four methyl groups attached to the nitrogen atoms, contributing to its stability and solubility in organic solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits low volatility and is relatively stable under standard conditions. N,N,N',N'-Tetramethylpropanediamide is known for its use as a reagent in organic synthesis and as a potential ligand in coordination chemistry due to its ability to coordinate with metal ions. Its properties include moderate polarity, which allows it to interact with various substrates in chemical reactions. Additionally, it is important to handle this compound with care, as it may pose health risks if ingested or inhaled, necessitating appropriate safety measures during use.
Formula:C7H14N2O2
InChI:InChI=1/C7H14N2O2/c1-8(2)6(10)5-7(11)9(3)4/h5H2,1-4H3
InChI key:AOXCXILUIVQCHH-UHFFFAOYSA-N
SMILES:CN(C)C(=O)CC(=O)N(C)C
Synonyms:
  • N,N,N',N'-Tetramethylmalonamide
  • propanediamide, N1
Found 5 products.