CymitQuimica logo

CAS 73139-85-2

:

5-Fluoroindole-3-acetonitrile

Description:
5-Fluoroindole-3-acetonitrile is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 5-position of the indole ring and an acetonitrile group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in organic solvents. It is of interest in medicinal chemistry and research due to its potential biological activities, including its role as a building block in the synthesis of various pharmaceuticals. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of derivatives, making them more effective in biological systems. Additionally, 5-Fluoroindole-3-acetonitrile may exhibit interesting reactivity patterns in organic synthesis, allowing for the development of novel compounds with desired pharmacological properties. As with many chemical substances, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C10H7FN2
InChI:InChI=1/C10H7FN2/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10/h1-2,5-6,13H,3H2
SMILES:c1cc2c(cc1F)c(CC#N)c[nH]2
Synonyms:
  • (5-Fluoro-1H-indol-3-yl)acetonitrile
  • 1H-indole-3-acetonitrile, 5-fluoro-(5-fluoro-1H-indol-3-yl)acetonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.