CAS 73141-46-5
:3-Hydroxysebacic acid
Description:
3-Hydroxysebacic acid, with the CAS number 73141-46-5, is a dicarboxylic acid characterized by the presence of two carboxyl functional groups (-COOH) and a hydroxyl group (-OH) on its carbon chain. It is derived from sebacic acid, which consists of a ten-carbon chain, and the hydroxyl group is located at the third carbon position. This compound is typically a white crystalline solid and is soluble in water and organic solvents, making it versatile for various applications. Its chemical structure allows it to participate in esterification reactions, making it useful in the synthesis of polyesters and other polymers. Additionally, 3-hydroxysebacic acid can serve as a building block in the production of biodegradable materials and has potential applications in the pharmaceutical and cosmetic industries due to its biocompatibility. The compound's properties, such as melting point and boiling point, can vary based on purity and environmental conditions, but it generally exhibits stability under standard conditions.
Formula:C10H18O5
InChI:InChI=1S/C10H18O5/c11-8(7-10(14)15)5-3-1-2-4-6-9(12)13/h8,11H,1-7H2,(H,12,13)(H,14,15)
InChI key:InChIKey=OQYZCCKCJQWHIE-UHFFFAOYSA-N
SMILES:C(CCCCCCC(O)=O)(CC(O)=O)O
Synonyms:- 3-Hydroxydecanedioic acid
- 3-Hydroxydecanedioicacid
- 3-Hydroxysebacic acid
- Decanedioic acid, 3-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
3-Hydroxysebacic acid
CAS:3-Hydroxysebacic acid, an endogenous metabolite found in urine, is utilized in the study of Medium Chain Acyl-CoA Dehydrogenase Deficiency (MCADD) [1] [2].Formula:C10H18O5Color and Shape:SolidMolecular weight:218.253-Hydroxy Sebacic Acid
CAS:Controlled ProductApplications 3-Hydroxysebacic acid is a normal urinary 3-hydroxydicarboxylic acid metabolite and can be elevated in patients with peroxisomal disorders such as Zellweger syndrome.
References Bernier, F., et al.: Neurology, 59, 1406 (2002), Boekema, E., et al.: J. Biol. Chem., 282, 1 (2007), Goodacre, R., et al.: Metabolomics, 3, 231 (2007),Formula:C10H18O5Color and Shape:Light GreyMolecular weight:218.25


