CAS 7315-68-6
:β-Methylbenzenebutanoic acid
Description:
β-Methylbenzenebutanoic acid, also known as 3-methyl-4-phenylbutanoic acid, is an organic compound characterized by its carboxylic acid functional group and a branched hydrocarbon chain. It features a phenyl group attached to a butanoic acid backbone, with a methyl group positioned on the beta carbon relative to the carboxylic acid. This structure contributes to its unique physical and chemical properties, including its solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the phenyl group. The compound may exhibit moderate acidity, typical of carboxylic acids, and can participate in various chemical reactions, such as esterification and amidation. Its potential applications may include use in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical compounds. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H14O2
InChI:InChI=1S/C11H14O2/c1-9(8-11(12)13)7-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H,12,13)
InChI key:InChIKey=CJBVVZBGGFKPDA-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)C)C1=CC=CC=C1
Synonyms:- β-Methylbenzenebutanoic acid
- Butyric acid, 3-methyl-4-phenyl-
- β-Benzyl-β-methylpropionic acid
- Benzenebutanoic acid, β-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.