CAS 7315-93-7
:9H-fluorene-4-carbonyl chloride
Description:
9H-Fluorene-4-carbonyl chloride, with the CAS number 7315-93-7, is an organic compound characterized by the presence of a carbonyl chloride functional group attached to the fluorene structure. This compound features a bicyclic aromatic system, which contributes to its stability and reactivity. The carbonyl chloride group makes it a versatile intermediate in organic synthesis, particularly in the formation of amides and esters through nucleophilic acyl substitution reactions. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is sensitive to moisture and should be handled under anhydrous conditions to prevent hydrolysis, which can lead to the formation of the corresponding carboxylic acid. Its reactivity and structural features make it useful in various chemical applications, including the synthesis of pharmaceuticals and agrochemicals. Safety precautions should be taken when handling this compound, as it can be corrosive and may pose health risks if inhaled or in contact with skin.
Formula:C14H9ClO
InChI:InChI=1/C14H9ClO/c15-14(16)12-7-3-5-10-8-9-4-1-2-6-11(9)13(10)12/h1-7H,8H2
SMILES:c1ccc2c(c1)Cc1cccc(c21)C(=O)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.