CAS 73161-81-6

(4-Chlorophenyl)(2-phenyl-5-thiazolyl)methanone

Description:

(4-Chlorophenyl)(2-phenyl-5-thiazolyl)methanone, with the CAS number 73161-81-6, is an organic compound characterized by its complex structure that includes a thiazole ring and a chlorophenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to the presence of the thiazole moiety, which is known for its role in various pharmacological applications. The chlorophenyl group may contribute to its lipophilicity, influencing its solubility and interaction with biological systems. In terms of reactivity, the carbonyl group in the methanone structure can participate in nucleophilic addition reactions, making it a versatile intermediate in organic synthesis. Additionally, the compound may display specific spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization. Overall, this compound's unique structural features suggest potential utility in medicinal chemistry and materials science.

Formula: C₁₆H₁₀ClNOS

InChI: InChI=1S/C16H10ClNOS/c17-13-8-6-11(7-9-13)15(19)14-10-18-16(20-14)12-4-2-1-3-5-12/h1-10H

InChI key: InChIKey=ZAZDOXUWFOXDEZ-UHFFFAOYSA-N

SMILES: C(=O)(C=1SC(=NC1)C2=CC=CC=C2)C3=CC=C(Cl)C=C3

Synonyms:

• (4-Chlorophenyl)(2-phenyl-5-thiazolyl)methanone
• Methanone, (4-chlorophenyl)(2-phenyl-5-thiazolyl)-