CAS 73166-28-6: 5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol

Description:5-Ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol, with the CAS number 73166-28-6, is an organic compound characterized by its polycyclic aromatic structure, which includes a phenanthrene core. This compound features a vinyl group (ethenyl) and a methyl group, contributing to its unique reactivity and potential applications in organic synthesis. The presence of hydroxyl groups at the 2 and 7 positions of the phenanthrene structure indicates that it is a diol, which can participate in hydrogen bonding and may exhibit solubility in polar solvents. The compound's structure suggests it may have interesting photophysical properties, making it a candidate for studies in materials science or organic electronics. Additionally, the presence of multiple functional groups can influence its chemical behavior, including reactivity in various chemical reactions such as oxidation or polymerization. Overall, 5-ethenyl-1-methyl-9,10-dihydrophenanthrene-2,7-diol is a complex molecule with potential utility in various chemical applications, although specific properties such as melting point, boiling point, and solubility would require empirical measurement.

Formula:C₁₇H₁₆O₂

InChI:InChI=1/C17H16O2/c1-3-11-8-13(18)9-12-4-5-14-10(2)16(19)7-6-15(14)17(11)12/h3,6-9,18-19H,1,4-5H2,2H3

Synonyms:
2,7-Phenanthrenediol, 5-Ethenyl-9,10-Dihydro-1-Methyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
Effusol REF: TM-TN1601CAS: 73166-28-6	99.67%	74.00 €~224.00 €	Wed 30 Apr 25
Effusol REF: BP-BP3616CAS: 73166-28-6	95%~99%	180.00 €~466.00 €	Fri 02 May 25
Effusol REF: 3D-FE22645CAS: 73166-28-6	Min. 95%	- - -	Discontinued product