CAS 73168-74-8
:hydroxy(3-hydroxy-4-methoxyphenyl)acetonitrile
Description:
Hydroxy(3-hydroxy-4-methoxyphenyl)acetonitrile, with the CAS number 73168-74-8, is an organic compound characterized by its functional groups, including a hydroxyl group, a methoxy group, and a nitrile group. This compound features a phenolic structure, which contributes to its potential biological activity and reactivity. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methoxy group can influence its electronic properties and steric hindrance. The acetonitrile moiety indicates that it contains a cyano group, which can participate in various chemical reactions, including nucleophilic additions. Hydroxy(3-hydroxy-4-methoxyphenyl)acetonitrile may exhibit antioxidant properties due to its phenolic structure, making it of interest in pharmaceutical and biochemical research. Its specific applications and behavior in chemical reactions would depend on the context of its use, including potential interactions with other molecules and its stability under various conditions. Overall, this compound represents a unique combination of functional groups that may confer diverse chemical and biological properties.
Formula:C9H9NO3
InChI:InChI=1/C9H9NO3/c1-13-9-3-2-6(4-7(9)11)8(12)5-10/h2-4,8,11-12H,1H3
SMILES:COc1ccc(cc1O)C(C#N)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)acetonitrile
CAS:Controlled ProductFormula:C9H9NO3Color and Shape:NeatMolecular weight:179.173
