CAS 73172-56-2
:ethyl 5-oxo-5-phenylpentanoate
Description:
Ethyl 5-oxo-5-phenylpentanoate, with the CAS number 73172-56-2, is an organic compound characterized by its ester functional group, which is derived from the reaction of an alcohol (ethanol) and a carboxylic acid. This compound features a five-carbon chain with a ketone group (5-oxo) and a phenyl group attached to the central carbon, contributing to its unique properties. It is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in flavoring and fragrance applications. Ethyl 5-oxo-5-phenylpentanoate is soluble in organic solvents and exhibits moderate stability under standard conditions. Its reactivity may include participation in nucleophilic addition reactions due to the presence of the carbonyl group. Additionally, it may undergo hydrolysis in the presence of water, leading to the formation of the corresponding acid and alcohol. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if ingested or inhaled.
Formula:C13H16O3
InChI:InChI=1/C13H16O3/c1-2-16-13(15)10-6-9-12(14)11-7-4-3-5-8-11/h3-5,7-8H,2,6,9-10H2,1H3
SMILES:CCOC(=O)CCCC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.