CAS 73177-35-2

2-methyl-1H-pyrrolo[3,2-b]pyridine

Description:

2-Methyl-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a methyl group at the 2-position of the pyrrole ring, which contributes to its unique chemical properties. It typically exhibits a pale yellow to brownish color and is soluble in organic solvents. The presence of nitrogen atoms in its structure imparts basicity and potential reactivity, making it of interest in various chemical reactions and applications. This compound may also exhibit biological activity, which has led to research in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure allows for potential interactions with biological targets, making it a subject of interest in drug discovery. As with many nitrogen-containing heterocycles, it may participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₈N₂

InChI: InChI=1/C8H8N2/c1-6-5-8-7(10-6)3-2-4-9-8/h2-5,10H,1H3

SMILES: Cc1cc2c(cccn2)[nH]1

2-Methyl-4-azaindole

CAS: 73177-35-2

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.1625

Ref: IN-DA00FDBL

2-Methyl-1H-pyrrolo[3,2-b]pyridine

CAS: 73177-35-2

2-Methyl-1H-pyrrolo[3,2-b]pyridine

Purity: 98%

Molecular weight: 132.16g/mol

Ref: 54-OR81801

2-Methyl-1H-pyrrolo[3,2-b]pyridine

CAS: 73177-35-2

Formula: C₈H₈N₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 132.166

Ref: 10-F208803

2-Methyl-4-azaindole

Controlled Product

CAS: 73177-35-2

Formula: C₈H₈N₂

Color and Shape: Neat

Molecular weight: 132.162

Ref: TR-M288655