CAS 731772-09-1

1-chloro-4-(2-chloroprop-2-enyl)benzene

Description:

1-Chloro-4-(2-chloroprop-2-enyl)benzene, with the CAS number 731772-09-1, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a propenyl group. The presence of the chloro substituents indicates that it is a chlorinated compound, which can influence its reactivity and physical properties. This compound is likely to exhibit hydrophobic characteristics due to the benzene ring, making it less soluble in water but more soluble in organic solvents. Its structure suggests potential applications in organic synthesis, particularly in the production of other chemical intermediates or as a reagent in various chemical reactions. Additionally, the presence of multiple chlorine atoms may impart specific biological activities or toxicity, necessitating careful handling and consideration of safety protocols during use. Overall, 1-chloro-4-(2-chloroprop-2-enyl)benzene is a compound of interest in both industrial and research settings, particularly in the fields of organic chemistry and materials science.

Formula: C₉H₈Cl₂

InChI: InChI=1/C9H8Cl2/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5H,1,6H2

SMILES: C=C(Cc1ccc(cc1)Cl)Cl

4-(2-Chloroprop-2-en-1-yl)chlorobenzene

CAS: 731772-09-1

4-(2-Chloroprop-2-en-1-yl)chlorobenzene

Purity: ≥95%

Ref: 54-OR01896