CAS 731772-71-7
:3-(2-bromoprop-2-enyl)benzonitrile
Description:
3-(2-Bromoprop-2-enyl)benzonitrile is an organic compound characterized by its unique structure, which includes a benzene ring substituted with a cyano group and a 2-bromoprop-2-enyl moiety. This compound features a nitrile functional group (-C≡N) that contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The compound's molecular structure suggests it may exhibit interesting physical properties, such as solubility in organic solvents and potential reactivity under specific conditions. Additionally, the presence of both aromatic and aliphatic components may influence its stability and interaction with other chemical species. As with many brominated compounds, considerations regarding environmental impact and safety are essential, particularly in terms of handling and disposal. Overall, 3-(2-bromoprop-2-enyl)benzonitrile serves as a valuable building block in synthetic organic chemistry.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c1-8(11)5-9-3-2-4-10(6-9)7-12/h2-4,6H,1,5H2
SMILES:C=C(Cc1cccc(c1)C#N)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.