CAS 731772-77-3
:ethyl 2-but-3-enylbenzoate
Description:
Ethyl 2-but-3-enylbenzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and an alcohol. This compound features a benzoate moiety, where the ethyl group is attached to the oxygen of the ester, and a but-3-enyl group that introduces a double bond into the structure, contributing to its reactivity and potential applications in organic synthesis. Ethyl 2-but-3-enylbenzoate is typically a colorless to pale yellow liquid with a pleasant aroma, making it potentially useful in the fragrance and flavor industries. Its structure allows for various chemical reactions, including polymerization and addition reactions, due to the presence of the double bond. Additionally, the compound may exhibit properties such as solubility in organic solvents and varying degrees of stability depending on environmental conditions. As with many organic compounds, safety data sheets should be consulted for handling and storage guidelines to ensure safe usage in laboratory or industrial settings.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-3-5-8-11-9-6-7-10-12(11)13(14)15-4-2/h3,6-7,9-10H,1,4-5,8H2,2H3
SMILES:C=CCCc1ccccc1C(=O)OCC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.