CAS 731772-79-5
:ethyl 2-(3-chlorobut-3-enyl)benzoate
Description:
Ethyl 2-(3-chlorobut-3-enyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of a chlorinated butenyl side chain contributes to its reactivity and potential applications in organic synthesis. This compound typically exhibits a moderate boiling point and solubility in organic solvents, reflecting its non-polar characteristics due to the aromatic ring and aliphatic chain. The chlorobut-3-enyl moiety introduces a site for potential electrophilic substitution reactions, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound may display specific optical properties due to the arrangement of its substituents, which can influence its behavior in various chemical reactions. Its CAS number, 731772-79-5, allows for easy identification and reference in chemical databases. Overall, ethyl 2-(3-chlorobut-3-enyl)benzoate is of interest in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C13H15ClO2
InChI:InChI=1/C13H15ClO2/c1-3-16-13(15)12-7-5-4-6-11(12)9-8-10(2)14/h4-7H,2-3,8-9H2,1H3
SMILES:CCOC(=O)c1ccccc1CCC(=C)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.