CymitQuimica logo

CAS 731772-80-8

:

ethyl 2-(2-bromoprop-2-enyl)benzoate

Description:
Ethyl 2-(2-bromoprop-2-enyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of the bromopropenyl group introduces notable reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and additions. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. Its molecular structure features a benzene ring, an ethyl ester group, and a brominated allylic side chain, contributing to its unique chemical properties. Ethyl 2-(2-bromoprop-2-enyl)benzoate is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic components. Additionally, it may possess biological activity, making it of interest in medicinal chemistry and synthetic applications. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks. Overall, this compound serves as a versatile intermediate in organic synthesis and research.
Formula:C12H13BrO2
InChI:InChI=1/C12H13BrO2/c1-3-15-12(14)11-7-5-4-6-10(11)8-9(2)13/h4-7H,2-3,8H2,1H3
SMILES:CCOC(=O)c1ccccc1CC(=C)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.