CAS 731772-81-9
:ethyl 2-(3-bromobut-3-enyl)benzoate
Description:
Ethyl 2-(3-bromobut-3-enyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of the 3-bromobut-3-enyl moiety introduces a bromine atom and a double bond into the structure, contributing to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. Its molecular structure suggests it may exhibit moderate polarity due to the ester and aromatic components, influencing its solubility in various organic solvents. Ethyl 2-(3-bromobut-3-enyl)benzoate may participate in various chemical reactions, including nucleophilic substitutions and additions, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling and storage, as the presence of bromine can pose health hazards. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.
Formula:C13H15BrO2
InChI:InChI=1/C13H15BrO2/c1-3-16-13(15)12-7-5-4-6-11(12)9-8-10(2)14/h4-7H,2-3,8-9H2,1H3
SMILES:CCOC(=O)c1ccccc1CCC(=C)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.