CymitQuimica logo

CAS 731772-82-0

:

ethyl 2-(2-methylprop-2-enyl)benzoate

Description:
Ethyl 2-(2-methylprop-2-enyl)benzoate, identified by its CAS number 731772-82-0, is an organic compound that belongs to the class of esters. It is characterized by the presence of a benzoate moiety, which is an aromatic ring attached to a carboxylate group, and an ethyl group that contributes to its ester functionality. The compound features a branched alkenyl substituent, specifically a 2-methylprop-2-enyl group, which introduces unsaturation and steric hindrance, influencing its reactivity and physical properties. Ethyl 2-(2-methylprop-2-enyl)benzoate is typically a colorless to pale yellow liquid with a pleasant odor, making it potentially useful in fragrance and flavor applications. Its chemical structure suggests it may exhibit moderate solubility in organic solvents while being less soluble in water. Additionally, the presence of the double bond in the alkenyl group may allow for further chemical transformations, such as polymerization or addition reactions. As with many organic compounds, safety data should be consulted for handling and usage guidelines.
Formula:C13H16O2
InChI:InChI=1/C13H16O2/c1-4-15-13(14)12-8-6-5-7-11(12)9-10(2)3/h5-8H,2,4,9H2,1,3H3
SMILES:CCOC(=O)c1ccccc1CC(=C)C
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.