CAS 731772-86-4

ethyl 3-(2-bromoprop-2-enyl)benzoate

Description:

Ethyl 3-(2-bromoprop-2-enyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The presence of the 2-bromoprop-2-enyl group introduces a bromine atom and a double bond into the molecular structure, contributing to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid with a distinct aromatic odor. Its molecular structure suggests it may exhibit moderate polarity due to the ester and aromatic components, influencing its solubility in various organic solvents. Ethyl 3-(2-bromoprop-2-enyl)benzoate may participate in various chemical reactions, such as nucleophilic substitutions or additions, making it a valuable intermediate in the synthesis of more complex organic molecules. Safety data should be consulted for handling, as the presence of bromine can pose health risks. Overall, this compound is of interest in both academic research and industrial applications, particularly in the fields of pharmaceuticals and agrochemicals.

Formula: C₁₂H₁₃BrO₂

InChI: InChI=1/C12H13BrO2/c1-3-15-12(14)11-6-4-5-10(8-11)7-9(2)13/h4-6,8H,2-3,7H2,1H3

SMILES: CCOC(=O)c1cccc(CC(=C)Br)c1

Synonyms:

• 2-BROMO-3-(3-CARBOETHOXYPHENYL)-1-PROPENE
• Benzoic acid, 3-(2-bromo-2-propen-1-yl)-, ethyl ester