CAS 731772-89-7
:ethyl 4-(2-chloroprop-2-enyl)benzoate
Description:
Ethyl 4-(2-chloroprop-2-enyl)benzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and ethanol. This compound features a chloropropenyl substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the chlorine atom in the prop-2-enyl group enhances its electrophilic character, making it a useful intermediate in various chemical reactions, including nucleophilic substitutions and additions. Ethyl 4-(2-chloroprop-2-enyl)benzoate is typically a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents and may exhibit moderate stability under standard conditions. Safety considerations should be taken into account, as compounds containing chlorine can pose health risks and environmental concerns. Overall, this compound is of interest in fields such as medicinal chemistry and materials science, where its unique structure can be leveraged for the development of new chemical entities or materials.
Formula:C12H13ClO2
InChI:InChI=1/C12H13ClO2/c1-3-15-12(14)11-6-4-10(5-7-11)8-9(2)13/h4-7H,2-3,8H2,1H3
SMILES:CCOC(=O)c1ccc(cc1)CC(=C)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.