CAS 731772-90-0
:ethyl 4-(3-chlorobut-3-enyl)benzoate
Description:
Ethyl 4-(3-chlorobut-3-enyl)benzoate is an organic compound characterized by its ester functional group, which is derived from benzoic acid and ethanol. The structure features a benzoate moiety with a substituent that includes a 3-chlorobut-3-enyl group, indicating the presence of a chlorinated alkene. This compound is likely to exhibit properties typical of esters, such as being relatively non-polar, which can influence its solubility in organic solvents while being less soluble in water. The presence of the chlorine atom may impart unique reactivity, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions or eliminations. Additionally, the compound may possess specific biological activities or applications in fields such as pharmaceuticals or agrochemicals, although detailed studies would be necessary to elucidate these aspects. Safety and handling precautions should be observed due to the presence of chlorine and the potential for reactivity associated with the alkene functionality.
Formula:C13H15ClO2
InChI:InChI=1/C13H15ClO2/c1-3-16-13(15)12-8-6-11(7-9-12)5-4-10(2)14/h6-9H,2-5H2,1H3
SMILES:CCOC(=O)c1ccc(CCC(=C)Cl)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.