CAS 731772-91-1
:ethyl 4-(3-bromobut-3-enyl)benzoate
Description:
Ethyl 4-(3-bromobut-3-enyl)benzoate is an organic compound characterized by its ester functional group, which is formed from the reaction of benzoic acid and ethanol. The presence of the 3-bromobut-3-enyl group introduces a bromine atom and a double bond into the structure, contributing to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to pale yellow liquid with a distinctive aromatic odor. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitutions or eliminations, making it a valuable intermediate in the synthesis of more complex molecules. Additionally, the compound's structure suggests potential applications in medicinal chemistry and materials science, where its unique properties can be exploited. Safety precautions should be taken when handling this compound, as it may pose health risks associated with brominated organic compounds.
Formula:C13H15BrO2
InChI:InChI=1/C13H15BrO2/c1-3-16-13(15)12-8-6-11(7-9-12)5-4-10(2)14/h6-9H,2-5H2,1H3
SMILES:CCOC(=O)c1ccc(CCC(=C)Br)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.