CAS 731772-92-2
:ethyl 4-(3-methylbut-3-enyl)benzoate
Description:
Ethyl 4-(3-methylbut-3-enyl)benzoate is an organic compound classified as an ester, characterized by its structure which includes a benzoate moiety and a branched alkyl chain. This compound features an ethyl group attached to the carboxylate part, contributing to its ester classification. The presence of the 3-methylbut-3-enyl group introduces a degree of unsaturation and branching, which can influence its physical properties, such as boiling point and solubility. Ethyl 4-(3-methylbut-3-enyl)benzoate is likely to exhibit a pleasant, fruity aroma, typical of many esters, making it potentially useful in flavor and fragrance applications. Additionally, its unique structure may impart specific reactivity patterns, making it of interest in synthetic organic chemistry. The compound's stability and reactivity can be influenced by factors such as temperature and the presence of catalysts or other reagents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.
Formula:C14H18O2
InChI:InChI=1/C14H18O2/c1-4-16-14(15)13-9-7-12(8-10-13)6-5-11(2)3/h7-10H,2,4-6H2,1,3H3
SMILES:CCOC(=O)c1ccc(CCC(=C)C)cc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.