CAS 731772-93-3
:1-(2-chloroprop-2-enyl)-2-fluoro-benzene
Description:
1-(2-Chloroprop-2-enyl)-2-fluoro-benzene, with the CAS number 731772-93-3, is an organic compound characterized by the presence of both a fluorine atom and a chloropropenyl group attached to a benzene ring. This compound features a vinyl group that is substituted with chlorine, indicating potential reactivity due to the presence of the double bond. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's lipophilicity and influencing its reactivity in various chemical reactions. The presence of both halogens (fluorine and chlorine) can also affect the compound's stability and interaction with biological systems, making it of interest in medicinal chemistry and materials science. Additionally, the structural configuration suggests that it may exhibit specific stereochemical properties, which could influence its behavior in chemical reactions and interactions. Overall, this compound's unique combination of functional groups makes it a subject of interest for further research in synthetic chemistry and potential applications in pharmaceuticals or agrochemicals.
Formula:C9H8ClF
InChI:InChI=1/C9H8ClF/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5H,1,6H2
SMILES:C=C(Cc1ccccc1F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.