CAS 731772-94-4

1-(3-chlorobut-3-enyl)-2-fluoro-benzene

Description:

1-(3-Chlorobut-3-enyl)-2-fluoro-benzene, with the CAS number 731772-94-4, is an organic compound characterized by the presence of both a fluorobenzene and a chlorobutene moiety. This compound features a benzene ring substituted with a fluorine atom at the second position and a 3-chlorobut-3-enyl group at the first position. The presence of the double bond in the butenyl chain introduces reactivity, making it a potential candidate for various chemical reactions, such as electrophilic addition or polymerization. The chlorine atom contributes to the compound's overall polarity and can influence its solubility in different solvents. Additionally, the fluorine atom can enhance the compound's stability and alter its electronic properties. Overall, this compound may exhibit interesting physical and chemical properties, including specific boiling and melting points, solubility characteristics, and reactivity patterns, which can be explored further in synthetic and medicinal chemistry contexts.

Formula: C₁₀H₁₀ClF

InChI: InChI=1/C10H10ClF/c1-8(11)6-7-9-4-2-3-5-10(9)12/h2-5H,1,6-7H2

SMILES: C=C(CCc1ccccc1F)Cl