CAS 731772-95-5

1-(2-Bromo-2-propen-1-yl)-2-fluorobenzene

Description:

1-(2-Bromo-2-propen-1-yl)-2-fluorobenzene, with the CAS number 731772-95-5, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring. This compound features a vinyl group (2-bromo-2-propen-1-yl) attached to the benzene, which contributes to its reactivity and potential applications in organic synthesis. The fluorine atom introduces unique electronic properties, enhancing the compound's lipophilicity and influencing its interactions in biological systems. The presence of the bromine atom can also facilitate nucleophilic substitution reactions, making it a useful intermediate in the synthesis of more complex molecules. In terms of physical properties, it is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its reactivity and functional groups suggest potential applications in pharmaceuticals, agrochemicals, and materials science. However, handling precautions should be observed due to the presence of halogens, which can pose environmental and health risks.

Formula: C₉H₈BrF

InChI: InChI=1S/C9H8BrF/c1-7(10)6-8-4-2-3-5-9(8)11/h2-5H,1,6H2

InChI key: InChIKey=GEPFDTJCIOLMCU-UHFFFAOYSA-N

SMILES: C(C(Br)=C)C1=C(F)C=CC=C1

Synonyms:

• Benzene, 1-(2-bromo-2-propen-1-yl)-2-fluoro-
• Benzene, 1-(2-bromo-2-propenyl)-2-fluoro-
• 1-(2-Bromo-2-propen-1-yl)-2-fluorobenzene