CAS 731772-98-8
:1-fluoro-2-(3-methylbut-3-enyl)benzene
Description:
1-Fluoro-2-(3-methylbut-3-enyl)benzene, with the CAS number 731772-98-8, is an organic compound characterized by the presence of a fluorine atom and a substituted benzene ring. This compound features a fluoro group attached to the second carbon of the benzene ring, while a 3-methylbut-3-enyl group is attached at the para position. The presence of the fluorine atom contributes to its unique reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. The 3-methylbut-3-enyl substituent introduces a degree of steric hindrance and can influence the compound's physical properties, such as boiling point and solubility. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing nature of the fluorine atom, which can affect its behavior in chemical reactions. Overall, 1-fluoro-2-(3-methylbut-3-enyl)benzene is a valuable compound in organic synthesis and materials science, with potential applications in pharmaceuticals and agrochemicals.
Formula:C11H13F
InChI:InChI=1/C11H13F/c1-9(2)7-8-10-5-3-4-6-11(10)12/h3-6H,1,7-8H2,2H3
SMILES:C=C(C)CCc1ccccc1F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.