CAS 731773-06-1

1-(3-Bromo-3-buten-1-yl)-3-fluorobenzene

Description:

1-(3-Bromo-3-buten-1-yl)-3-fluorobenzene, with the CAS number 731773-06-1, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring. This compound features a butenyl side chain, which introduces unsaturation and contributes to its reactivity. The bromine atom is located at the 3-position of the butenyl group, while the fluorine is positioned at the 3-position of the benzene ring, indicating a specific orientation that can influence its chemical behavior and interactions. The presence of halogens typically enhances the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and materials science. Additionally, the compound's structure suggests potential for participation in electrophilic aromatic substitution reactions and other transformations. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the overall molecular structure. As with many halogenated compounds, it is essential to handle this substance with care due to potential toxicity and environmental concerns.

Formula: C₁₀H₁₀BrF

InChI: InChI=1S/C10H10BrF/c1-8(11)5-6-9-3-2-4-10(12)7-9/h2-4,7H,1,5-6H2

InChI key: InChIKey=FOHKDCDOASEWLM-UHFFFAOYSA-N

SMILES: C(CC(Br)=C)C1=CC(F)=CC=C1

Synonyms:

• 1-(3-Bromo-3-buten-1-yl)-3-fluorobenzene
• Benzene, 1-(3-bromo-3-buten-1-yl)-3-fluoro-
• Benzene, 1-(3-bromo-3-butenyl)-3-fluoro-