CAS 731773-07-2

1-fluoro-3-(3-methylbut-3-enyl)benzene

Description:

1-Fluoro-3-(3-methylbut-3-enyl)benzene, with the CAS number 731773-07-2, is an organic compound characterized by the presence of a fluorine atom and a substituted benzene ring. The structure features a fluoro group attached to the benzene at the meta position relative to a side chain that includes a 3-methylbut-3-enyl group, which introduces a degree of unsaturation and steric hindrance. This compound is likely to exhibit hydrophobic characteristics due to the aromatic nature of the benzene ring and the alkyl side chain, making it less soluble in polar solvents. The presence of the fluorine atom can enhance the compound's reactivity and influence its physical properties, such as boiling and melting points. Additionally, the compound may participate in various chemical reactions typical of aromatic compounds, including electrophilic substitution. Its unique structure may also impart specific biological activities or applications in materials science, pharmaceuticals, or agrochemicals, although detailed studies would be necessary to elucidate these aspects fully.

Formula: C₁₁H₁₃F

InChI: InChI=1/C11H13F/c1-9(2)6-7-10-4-3-5-11(12)8-10/h3-5,8H,1,6-7H2,2H3

SMILES: C=C(C)CCc1cccc(c1)F