CAS 731773-08-3
:1-(2-Chloro-2-propen-1-yl)-4-fluorobenzene
Description:
1-(2-Chloro-2-propen-1-yl)-4-fluorobenzene, with the CAS number 731773-08-3, is an organic compound characterized by the presence of both a chloroalkene and a fluorobenzene moiety. This compound features a vinyl group (2-chloro-2-propen-1-yl) attached to a benzene ring that has a fluorine substituent at the para position. The presence of the chlorine and fluorine atoms introduces significant polarity and reactivity, making it useful in various chemical applications, including as an intermediate in organic synthesis. The compound is likely to exhibit typical aromatic properties due to the benzene ring, such as stability and resonance. Additionally, the vinyl group may participate in various reactions, including polymerization and electrophilic addition. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific molecular interactions and the presence of functional groups. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.
Formula:C9H8ClF
InChI:InChI=1S/C9H8ClF/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5H,1,6H2
InChI key:InChIKey=FOUXGOWCGSOVLM-UHFFFAOYSA-N
SMILES:C(C(=C)Cl)C1=CC=C(F)C=C1
Synonyms:- Benzene, 1-(2-chloro-2-propenyl)-4-fluoro-
- 2-Chloro-3-(4-fluorophenyl)-1-propene
- 1-(2-Chloro-2-propen-1-yl)-4-fluorobenzene
- 1-(2-Chloroprop-2-enyl)-4-fluorobenzene
- Benzene, 1-(2-chloro-2-propen-1-yl)-4-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.