CAS 731773-09-4

1-(3-Chloro-3-buten-1-yl)-4-fluorobenzene

Description:

1-(3-Chloro-3-buten-1-yl)-4-fluorobenzene, with the CAS number 731773-09-4, is an organic compound characterized by its unique structure, which includes a fluorobenzene ring and a chloroalkene side chain. This compound features a four-carbon chain with a double bond and a chlorine substituent, contributing to its reactivity and potential applications in organic synthesis. The presence of the fluorine atom on the benzene ring enhances its electronic properties, making it a useful intermediate in the development of pharmaceuticals and agrochemicals. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic system, which can influence its solubility and biological activity. Additionally, the chloroalkene moiety may participate in various chemical reactions, such as nucleophilic substitutions or additions, making it a versatile building block in synthetic chemistry. Safety and handling precautions should be observed, as halogenated compounds can pose environmental and health risks. Overall, 1-(3-Chloro-3-buten-1-yl)-4-fluorobenzene represents a significant compound in the field of organic chemistry.

Formula: C₁₀H₁₀ClF

InChI: InChI=1S/C10H10ClF/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7H,1-3H2

InChI key: InChIKey=IMHZJYBTGUPQIK-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)C1=CC=C(F)C=C1

Synonyms:

• Benzene, 1-(3-chloro-3-butenyl)-4-fluoro-
• 1-(3-Chloro-3-buten-1-yl)-4-fluorobenzene
• Benzene, 1-(3-chloro-3-buten-1-yl)-4-fluoro-